EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O2S |
| Net Charge | 0 |
| Average Mass | 298.367 |
| Monoisotopic Mass | 298.07760 |
| SMILES | CN(C(=O)COc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S/c1-18(12-7-3-2-4-8-12)15(19)11-20-16-17-13-9-5-6-10-14(13)21-16/h2-10H,11H2,1H3 |
| InChIKey | XIGAUIHYSDTJHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimitotic Any compound that inhibits cell division (mitosis). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefenacet (CHEBI:34830) has role antimitotic (CHEBI:64911) |
| mefenacet (CHEBI:34830) has role herbicide (CHEBI:24527) |
| mefenacet (CHEBI:34830) is a benzothiazoles (CHEBI:37947) |
| mefenacet (CHEBI:34830) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 2-(1,3-benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide |
| Synonyms | Source |
|---|---|
| 2-(1,3-Benzothiazol-2-yloxy)-N-methylacetanilide | KEGG COMPOUND |
| méfénacet | ChEBI |
| Citations |
|---|