EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3483 - cefazolin sodium
| Formula | C14H13N8O4S3.Na |
| Net Charge | 0 |
| Average Mass | 476.501 |
| Monoisotopic Mass | 476.01196 |
| SMILES | [H][C@]12SCC(CSc3nnc(C)s3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)Cn1cnnn1.[Na+] |
| InChI | InChI=1S/C14H14N8O4S3.Na/c1-6-17-18-14(29-6)28-4-7-3-27-12-9(11(24)22(12)10(7)13(25)26)16-8(23)2-21-5-15-19-20-21;/h5,9,12H,2-4H2,1H3,(H,16,23)(H,25,26);/q;+1/p-1/t9-,12-;/m1./s1 |
| InChIKey | FLKYBGKDCCEQQM-WYUVZMMLSA-M |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefazolin sodium (CHEBI:3483) has part cefazolin(1−) (CHEBI:53657) |
| cefazolin sodium (CHEBI:3483) has role antibacterial agent (CHEBI:33282) |
| cefazolin sodium (CHEBI:3483) has role antiinfective agent (CHEBI:35441) |
| cefazolin sodium (CHEBI:3483) has role antineoplastic agent (CHEBI:35610) |
| cefazolin sodium (CHEBI:3483) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-7β-[(1H-tetrazol-1-ylacetyl)amino]-3,4-didehydrocepham-4-carboxylate |
| Synonyms | Source |
|---|---|
| 46083 | ChEMBL |
| Cefacidal | ChEMBL |
| Cefamedin | ChEMBL |
| Cefazil | ChEMBL |
| Cefazoline sodium | ChemIDplus |
| Cefazolin injection | ChEMBL |
| Brand Names | Source |
|---|---|
| Acef | ChEMBL |
| Ancef | ChEMBL |
| Cefazolin and dextrose | ChEMBL |
| Kefzol | ChEMBL |
| Zolicef | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4229326 | Beilstein |
| CAS:27164-46-1 | ChemIDplus |
| CAS:27164-46-1 | KEGG DRUG |
| Citations |
|---|