EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H19Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 464.352 |
| Monoisotopic Mass | 463.08543 |
| SMILES | CN1C(=O)[C@H](NC(=O)/C=C/c2ccc(Cl)cc2Cl)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H19Cl2N3O2/c1-30-21-10-6-5-9-19(21)23(17-7-3-2-4-8-17)29-24(25(30)32)28-22(31)14-12-16-11-13-18(26)15-20(16)27/h2-15,24H,1H3,(H,28,31)/b14-12+/t24-/m1/s1 |
| InChIKey | BYULDQRRUINTAA-SWDTZWKESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L 735821 (CHEBI:34807) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| L 735821 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13853 | KEGG COMPOUND |