EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16NO4PS |
| Net Charge | 0 |
| Average Mass | 313.315 |
| Monoisotopic Mass | 313.05377 |
| SMILES | CCOP(=S)(OCC)Oc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C13H16NO4PS/c1-3-15-19(20,16-4-2)18-13-10-12(17-14-13)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | SDMSCIWHRZJSRN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxathion (CHEBI:34801) has functional parent 5-phenylisoxazol-3-ol (CHEBI:38713) |
| isoxathion (CHEBI:34801) has role agrochemical (CHEBI:33286) |
| isoxathion (CHEBI:34801) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| isoxathion (CHEBI:34801) is a organic thiophosphate (CHEBI:37512) |
| isoxathion (CHEBI:34801) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-diethyl O-(5-phenyl-1,2-oxazol-3-yl) phosphorothionate |
| Synonyms | Source |
|---|---|
| Isoxathion | KEGG COMPOUND |
| Karphos | KEGG COMPOUND |
| O,O-diethyl O-(5-phenylisoxazol-3-yl) thiophosphate | IUPAC |
| O,O-Diethyl O-(3-(5-phenyl)-1,2-isoxazolyl)phosphorothionate | ChemIDplus |
| O,O-Diethyl O-(5-phenyl-3-isoxazolyl) phosphorothioate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14580 | KEGG COMPOUND |
| NZ190244 | Patent |
| EG17168 | Patent |
| Isoxathion | Wikipedia |
| 413 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1222135 | Reaxys |
| CAS:18854-01-8 | KEGG COMPOUND |
| CAS:18854-01-8 | ChemIDplus |
| CAS:18854-01-8 | NIST Chemistry WebBook |
| Citations |
|---|