EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO |
| Net Charge | 0 |
| Average Mass | 283.415 |
| Monoisotopic Mass | 283.19361 |
| SMILES | C#C/C=C/C[C@@H]1CCC[C@]2(CCC[C@H](O)[C@H]2/C=C/C#C)N1 |
| InChI | InChI=1S/C19H25NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h1-2,5-7,12,16-18,20-21H,8-11,13-15H2/b7-5+,12-6+/t16-,17-,18+,19-/m1/s1 |
| InChIKey | JBRYWENFVHQBGY-GFSCOHCQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histrionicotoxin (CHEBI:34792) has role metabolite (CHEBI:25212) |
| histrionicotoxin (CHEBI:34792) is a azaspiro compound (CHEBI:35624) |
| histrionicotoxin (CHEBI:34792) is a secondary alcohol (CHEBI:35681) |
| histrionicotoxin (CHEBI:34792) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (2S,6R,7S,8S)-7-[(1E)-but-1-en-3-yn-1-yl]-2-[(2E)-pent-2-en-4-yn-1-yl]-1-azaspiro[5.5]undecan-8-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4192658 | Reaxys |
| CAS:34272-51-0 | KEGG COMPOUND |
| CAS:34272-51-0 | ChemIDplus |
| Citations |
|---|