EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClN3O4S |
| Net Charge | 0 |
| Average Mass | 367.814 |
| Monoisotopic Mass | 367.03935 |
| SMILES | [H][C@]12SCC(Cl)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C15H14ClN3O4S/c16-8-6-24-14-10(13(21)19(14)11(8)15(22)23)18-12(20)9(17)7-4-2-1-3-5-7/h1-5,9-10,14H,6,17H2,(H,18,20)(H,22,23)/t9-,10-,14-/m1/s1 |
| InChIKey | QYIYFLOTGYLRGG-GPCCPHFNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefaclor (CHEBI:3478) has role antibacterial drug (CHEBI:36047) |
| cefaclor (CHEBI:3478) has role drug allergen (CHEBI:88188) |
| cefaclor (CHEBI:3478) is a cephalosporin (CHEBI:23066) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-3,4-didehydrocepham-4-carboxylic acid |
| INN | Source |
|---|---|
| cefaclorum | DrugBank |
| Synonyms | Source |
|---|---|
| Cefaclor | KEGG COMPOUND |
| cefaclor | ChEMBL |
| Cefaclor anhydrous | ChemIDplus |
| CCL | KEGG DRUG |
| 3-Chloro-7-D-(2-phenylglycinamido)-3-cephem-4-carboxylic acid | ChemIDplus |
| Cephaclor | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3632473 | Reaxys |
| CAS:53994-73-3 | KEGG COMPOUND |
| CAS:53994-73-3 | ChemIDplus |
| CAS:53994-73-3 | KEGG DRUG |
| CAS:53994-73-3 | DrugBank |
| Citations |
|---|