EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N2O5 |
| Net Charge | 0 |
| Average Mass | 484.637 |
| Monoisotopic Mass | 484.29372 |
| SMILES | COc1ccc(CCN(C)CCCC(C#N)(c2cc(OC)c(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C28H40N2O5/c1-20(2)28(19-29,22-17-25(33-6)27(35-8)26(18-22)34-7)13-9-14-30(3)15-12-21-10-11-23(31-4)24(16-21)32-5/h10-11,16-18,20H,9,12-15H2,1-8H3 |
| InChIKey | XQLWNAFCTODIRK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gallopamil (CHEBI:34772) has role anti-asthmatic agent (CHEBI:65023) |
| Gallopamil (CHEBI:34772) has role cardiovascular drug (CHEBI:35554) |
| Gallopamil (CHEBI:34772) is a benzenes (CHEBI:22712) |
| Gallopamil (CHEBI:34772) is a organic amino compound (CHEBI:50047) |
| INN | Source |
|---|---|
| galopamilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| D-600 | ChEMBL |
| DL-D-600 | ChEMBL |
| Gallopamil | KEGG COMPOUND |
| gallopamil HCl | DrugCentral |
| gallopamil hydrochloride | DrugCentral |
| LU-30-029 | ChEMBL |
| Citations |
|---|