EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34763 - flucythrinate
| Formula | C26H23F2NO4 |
| Net Charge | 0 |
| Average Mass | 451.469 |
| Monoisotopic Mass | 451.15951 |
| SMILES | CC(C)[C@H](C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3/t23?,24-/m0/s1 |
| InChIKey | GBIHOLCMZGAKNG-CGAIIQECSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucythrinate (CHEBI:34763) has functional parent 2-(4-hydroxyphenyl)-3-methylbutyric acid (CHEBI:39359) |
| flucythrinate (CHEBI:34763) has role agrochemical (CHEBI:33286) |
| flucythrinate (CHEBI:34763) has role pyrethroid ester acaricide (CHEBI:39259) |
| flucythrinate (CHEBI:34763) has role pyrethroid ester insecticide (CHEBI:39116) |
| flucythrinate (CHEBI:34763) is a organofluorine acaricide (CHEBI:38806) |
| flucythrinate (CHEBI:34763) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| cyano(3-phenoxyphenyl)methyl (2S)-2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate |
| Synonyms | Source |
|---|---|
| (±)-cyano-(3-phenoxyphenyl)methyl (+)-4-(difluoromethoxy)-α-(1-methylethyl)benzeneacetate | ChemIDplus |
| Flucythrinate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:70124-77-5 | KEGG COMPOUND |
| CAS:70124-77-5 | ChemIDplus |