EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7Cl3O3 |
| Net Charge | 0 |
| Average Mass | 269.511 |
| Monoisotopic Mass | 267.94608 |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14) |
| InChIKey | ZLSWBLPERHFHIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fenoprop (CHEBI:34758) has role phenoxy herbicide (CHEBI:60575) |
| Fenoprop (CHEBI:34758) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 2-(2,4,5-Trichlorophenoxy)propionic acid | KEGG COMPOUND |
| 2,4,5-TP | KEGG COMPOUND |
| Fenoprop | KEGG COMPOUND |
| Silvex | KEGG COMPOUND |