EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12NO5PS |
| Net Charge | 0 |
| Average Mass | 277.238 |
| Monoisotopic Mass | 277.01738 |
| SMILES | COP(=S)(OC)Oc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12NO5PS/c1-7-6-8(4-5-9(7)10(11)12)15-16(17,13-2)14-3/h4-6H,1-3H3 |
| InChIKey | ZNOLGFHPUIJIMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenitrothion (CHEBI:34757) has functional parent 4-nitro-m-cresol (CHEBI:38683) |
| fenitrothion (CHEBI:34757) has role acaricide (CHEBI:22153) |
| fenitrothion (CHEBI:34757) has role agrochemical (CHEBI:33286) |
| fenitrothion (CHEBI:34757) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| fenitrothion (CHEBI:34757) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| fenitrothion (CHEBI:34757) has role insecticide (CHEBI:24852) |
| fenitrothion (CHEBI:34757) is a C-nitro compound (CHEBI:35716) |
| fenitrothion (CHEBI:34757) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O,O-dimethyl O-(3-methyl-4-nitrophenyl)phosphorothioate |
| Synonyms | Source |
|---|---|
| Fenitrothion | KEGG COMPOUND |
| O,O-Dimethyl O-(3-methyl-4-nitrophenyl) phosphorothioate | KEGG COMPOUND |
| MEP | KEGG COMPOUND |
| O,O-dimethyl O-(3-methyl-4-nitrophenyl) thiophosphate | IUPAC |
| O,O-Dimethyl O-4-nitro-m-tolyl phosphorothioate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14442 | KEGG COMPOUND |
| HMDB0041893 | HMDB |
| Fenitrothion | Wikipedia |
| 299 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1887367 | Reaxys |
| CAS:122-14-5 | KEGG COMPOUND |
| CAS:122-14-5 | ChemIDplus |
| Citations |
|---|