EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12NO5PS |
| Net Charge | 0 |
| Average Mass | 277.238 |
| Monoisotopic Mass | 277.01738 |
| SMILES | COP(=S)(OC)Oc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12NO5PS/c1-7-6-8(4-5-9(7)10(11)12)15-16(17,13-2)14-3/h4-6H,1-3H3 |
| InChIKey | ZNOLGFHPUIJIMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenitrothion (CHEBI:34757) has functional parent 4-nitro-m-cresol (CHEBI:38683) |
| fenitrothion (CHEBI:34757) has role acaricide (CHEBI:22153) |
| fenitrothion (CHEBI:34757) has role agrochemical (CHEBI:33286) |
| fenitrothion (CHEBI:34757) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| fenitrothion (CHEBI:34757) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| fenitrothion (CHEBI:34757) has role insecticide (CHEBI:24852) |
| fenitrothion (CHEBI:34757) is a C-nitro compound (CHEBI:35716) |
| fenitrothion (CHEBI:34757) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O,O-dimethyl O-(3-methyl-4-nitrophenyl)phosphorothioate |
| Synonyms | Source |
|---|---|
| Fenitrothion | KEGG COMPOUND |
| O,O-Dimethyl O-(3-methyl-4-nitrophenyl) phosphorothioate | KEGG COMPOUND |
| MEP | KEGG COMPOUND |
| O,O-dimethyl O-(3-methyl-4-nitrophenyl) thiophosphate | IUPAC |
| O,O-Dimethyl O-4-nitro-m-tolyl phosphorothioate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14442 | KEGG COMPOUND |
| HMDB0041893 | HMDB |
| Fenitrothion | Wikipedia |
| 299 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1887367 | Reaxys |
| CAS:122-14-5 | KEGG COMPOUND |
| CAS:122-14-5 | ChemIDplus |
| Citations |
|---|