EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO2 |
| Net Charge | 0 |
| Average Mass | 213.236 |
| Monoisotopic Mass | 213.07898 |
| SMILES | O=C(O)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16) |
| InChIKey | ZWJINEZUASEZBH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | membrane transport modulator Any agent that affects the transport of molecular entities across a biological membrane. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenamic acid (CHEBI:34756) has functional parent anthranilic acid (CHEBI:30754) |
| fenamic acid (CHEBI:34756) has role membrane transport modulator (CHEBI:38632) |
| fenamic acid (CHEBI:34756) is a aminobenzoic acid (CHEBI:22495) |
| fenamic acid (CHEBI:34756) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(phenylamino)benzoic acid |
| Synonyms | Source |
|---|---|
| Fenamic acid | KEGG COMPOUND |
| Diphenylamine-2-carboxylic acid | KEGG COMPOUND |
| DPC | KEGG COMPOUND |
| N-phenylanthranilic acid | ChEBI |
| N-phenyl-ortho-aminobenzoic acid | ChemIDplus |
| ortho-anilinobenzoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C13697 | KEGG COMPOUND |
| Fenamic_acid | Wikipedia |
| US5212189 | Patent |
| LSM-6670 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1456607 | Reaxys |
| CAS:91-40-7 | KEGG COMPOUND |
| CAS:91-40-7 | ChemIDplus |
| Citations |
|---|