EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O3 |
| Net Charge | 0 |
| Average Mass | 396.571 |
| Monoisotopic Mass | 396.26645 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCC3CCCC3)CC[C@@]21[H] |
| InChI | InChI=1S/C26H36O3/c1-26-15-14-21-20-10-8-19(27)16-18(20)7-9-22(21)23(26)11-12-24(26)29-25(28)13-6-17-4-2-3-5-17/h8,10,16-17,21-24,27H,2-7,9,11-15H2,1H3/t21-,22-,23+,24+,26+/m1/s1 |
| InChIKey | UOACKFBJUYNSLK-XRKIENNPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Estradiol 17beta-cyclopentylpropionate (CHEBI:34745) is a steroid ester (CHEBI:47880) |
| Synonyms | Source |
|---|---|
| depoestradiol | DrugCentral |
| depoestradiol cypionate | DrugCentral |
| Estradiol 17.beta.-cyclopentanepropanoate | ChEMBL |
| Estradiol 17beta-cyclopentylpropionate | KEGG COMPOUND |
| Estradiol cipionate | ChEMBL |
| estradiol cyclopentylpropionate | DrugCentral |
| Brand Names | Source |
|---|---|
| Depo | ChEMBL |
| Depo-estradiol | ChEMBL |
| Estradiol cypionate component of depo-testadiol | ChEMBL |
| Estradiol cypionate component of lunelle | ChEMBL |
| Citations |
|---|