EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15O2PS2 |
| Net Charge | 0 |
| Average Mass | 310.380 |
| Monoisotopic Mass | 310.02511 |
| SMILES | CCOP(=O)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C14H15O2PS2/c1-2-16-17(15,18-13-9-5-3-6-10-13)19-14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | AWZOLILCOUMRDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. neurotoxin A poison that interferes with the functions of the nervous system. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edifenphos (CHEBI:34735) has role antifungal agrochemical (CHEBI:86328) |
| edifenphos (CHEBI:34735) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| edifenphos (CHEBI:34735) has role neurotoxin (CHEBI:50910) |
| edifenphos (CHEBI:34735) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| edifenphos (CHEBI:34735) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O-ethyl S,S-diphenyl phosphorodithioate |
| Synonyms | Source |
|---|---|
| Edifenphos | KEGG COMPOUND |
| EDDP | KEGG COMPOUND |
| O-Ethyl-S,S-diphenyl dithiophosphate | KEGG COMPOUND |
| Bayer 78418 | ChemIDplus |
| BAY 78418 | ChemIDplus |
| Phosphorodithioic acid, O-ethyl-S,S-diphenyl ester | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C14436 | KEGG COMPOUND |
| HMDB0031781 | HMDB |
| edifenphos | Alan Wood's Pesticides |
| 1205 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1988797 | Reaxys |
| CAS:17109-49-8 | KEGG COMPOUND |
| CAS:17109-49-8 | ChemIDplus |
| CAS:17109-49-8 | NIST Chemistry WebBook |
| Citations |
|---|