EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15O2PS2 |
| Net Charge | 0 |
| Average Mass | 310.380 |
| Monoisotopic Mass | 310.02511 |
| SMILES | CCOP(=O)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C14H15O2PS2/c1-2-16-17(15,18-13-9-5-3-6-10-13)19-14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | AWZOLILCOUMRDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edifenphos (CHEBI:34735) has role antifungal agrochemical (CHEBI:86328) |
| edifenphos (CHEBI:34735) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| edifenphos (CHEBI:34735) has role neurotoxin (CHEBI:50910) |
| edifenphos (CHEBI:34735) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| edifenphos (CHEBI:34735) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O-ethyl S,S-diphenyl phosphorodithioate |
| Synonyms | Source |
|---|---|
| BAY 78418 | ChemIDplus |
| Bayer 78418 | ChemIDplus |
| EDDP | KEGG COMPOUND |
| Edifenphos | KEGG COMPOUND |
| Ediphenophos | NIST Chemistry WebBook |
| O-Ethyl-S,S-diphenyl dithiophosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1205 | PPDB |
| C14436 | KEGG COMPOUND |
| edifenphos | Alan Wood's Pesticides |
| HMDB0031781 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1988797 | Reaxys |
| CAS:17109-49-8 | NIST Chemistry WebBook |
| CAS:17109-49-8 | KEGG COMPOUND |
| CAS:17109-49-8 | ChemIDplus |
| Citations |
|---|