EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14NO4PS |
| Net Charge | 0 |
| Average Mass | 323.310 |
| Monoisotopic Mass | 323.03812 |
| SMILES | CCOP(=S)(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C14H14NO4PS/c1-2-18-20(21,14-6-4-3-5-7-14)19-13-10-8-12(9-11-13)15(16)17/h3-11H,2H2,1H3 |
| InChIKey | AIGRXSNSLVJMEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EPN (CHEBI:34733) has role acaricide (CHEBI:22153) |
| EPN (CHEBI:34733) has role agrochemical (CHEBI:33286) |
| EPN (CHEBI:34733) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| EPN (CHEBI:34733) is a organic phosphonate (CHEBI:37592) |
| EPN (CHEBI:34733) is a organothiophosphate insecticide (CHEBI:25715) |
| EPN (CHEBI:34733) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| O-ethyl O-(4-nitrophenyl) phenylphosphonothioate |
| Synonyms | Source |
|---|---|
| O-ethyl O-(4-nitrophenyl)phenylphosphonothioate | NIST Chemistry WebBook |
| O-ethyl O-(p-nitrophenyl) phenylphosphonothioate | ChemIDplus |
| O-ethyl phenylphosphonothioic acid O-(4-nitrophenyl) ester | ChemIDplus |
| EPN | KEGG COMPOUND |
| ethyl p-nitrophenyl benzenethionophosphonate | ChemIDplus |
| O-ethyl O-p-nitrophenyl phenylphosphonothioate | KEGG COMPOUND |