EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N |
| Net Charge | 0 |
| Average Mass | 221.303 |
| Monoisotopic Mass | 221.12045 |
| SMILES | [H][C@]12Cc3ccccc3[C@](C)(N1)c1ccccc12 |
| InChI | InChI=1S/C16H15N/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16/h2-9,15,17H,10H2,1H3/t15-,16+/m1/s1 |
| InChIKey | LBOJYSIDWZQNJS-CVEARBPZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | anaesthetic Substance which produces loss of feeling or sensation. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. anticonvulsant A drug used to prevent seizures or reduce their severity. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dizocilpine (CHEBI:34725) has role anaesthetic (CHEBI:38867) |
| dizocilpine (CHEBI:34725) has role anticonvulsant (CHEBI:35623) |
| dizocilpine (CHEBI:34725) has role neuroprotective agent (CHEBI:63726) |
| dizocilpine (CHEBI:34725) has role nicotinic antagonist (CHEBI:48878) |
| dizocilpine (CHEBI:34725) has role NMDA receptor antagonist (CHEBI:60643) |
| dizocilpine (CHEBI:34725) is a secondary amino compound (CHEBI:50995) |
| dizocilpine (CHEBI:34725) is a tetracyclic antidepressant (CHEBI:50940) |
| dizocilpine (CHEBI:34725) is conjugate base of dizocilpine(1+) (CHEBI:176787) |
| Incoming Relation(s) |
| dizocilpine(1+) (CHEBI:176787) is conjugate acid of dizocilpine (CHEBI:34725) |
| IUPAC Name |
|---|
| (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene |
| INNs | Source |
|---|---|
| dizocilpine | WHO MedNet |
| dizocilpina | WHO MedNet |
| dizocilpinum | WHO MedNet |
| dizocilpine | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK801 | KEGG COMPOUND |
| MK 801 | ChemIDplus |
| MK-801 | LINCS |
| (+)-MK-801 | LINCS |
| (+)-dizocilpine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C13737 | KEGG COMPOUND |
| LSM-5688 | LINCS |
| Dizocilpine | Wikipedia |
| 156718 | ChemSpider |
| BMK | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:77086-21-6 | ChemIDplus |
| Citations |
|---|