EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3ClN2O4 |
| Net Charge | 0 |
| Average Mass | 202.553 |
| Monoisotopic Mass | 201.97813 |
| SMILES | O=[N+]([O-])c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3ClN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-chloro-2,4-dinitrobenzene (CHEBI:34718) has role allergen (CHEBI:50904) |
| 1-chloro-2,4-dinitrobenzene (CHEBI:34718) has role epitope (CHEBI:53000) |
| 1-chloro-2,4-dinitrobenzene (CHEBI:34718) has role sensitiser (CHEBI:139492) |
| 1-chloro-2,4-dinitrobenzene (CHEBI:34718) is a C-nitro compound (CHEBI:35716) |
| 1-chloro-2,4-dinitrobenzene (CHEBI:34718) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 1-chloro-2,4-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 1,3-Dinitro-4-chlorobenzene | ChemIDplus |
| 1-Chloro-2,4-dinitrobenzene | KEGG COMPOUND |
| 1-Chloro-2,4-dinitrobenzol | ChemIDplus |
| 2,4-Dinitro-1-chlorobenzene | ChemIDplus |
| 2,4-Dinitrochlorobenzene | NIST Chemistry WebBook |
| 2,4-Dinitrophenyl chloride | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-chloro-2,4-dinitrobenzene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2,4-Dinitrochlorobenzene | Wikipedia |
| C14397 | KEGG COMPOUND |
| Citations |
|---|