EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O2 |
| Net Charge | 0 |
| Average Mass | 336.435 |
| Monoisotopic Mass | 336.18378 |
| SMILES | [H][C@]12C=C(CC)[C@@]3([H])N(CCc4c(nc5ccccc45)[C@@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C21H24N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,10,13,19,22H,3,8-9,11-12H2,1-2H3/t13-,19+,21-/m0/s1 |
| InChIKey | CMKFQVZJOWHHDV-NQZBTDCJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catharanthus roseus (ncbitaxon:4058) | leaf (BTO:0000713) | PubMed (17909486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catharanthine (CHEBI:3469) is a alkaloid ester (CHEBI:38481) |
| catharanthine (CHEBI:3469) is a bridged compound (CHEBI:35990) |
| catharanthine (CHEBI:3469) is a methyl ester (CHEBI:25248) |
| catharanthine (CHEBI:3469) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| catharanthine (CHEBI:3469) is a organic heteropentacyclic compound (CHEBI:38164) |
| catharanthine (CHEBI:3469) is a tertiary amino compound (CHEBI:50996) |
| catharanthine (CHEBI:3469) is conjugate base of catharanthine(1+) (CHEBI:142675) |
| Incoming Relation(s) |
| catharanthine(1+) (CHEBI:142675) is conjugate acid of catharanthine (CHEBI:3469) |
| IUPAC Name |
|---|
| methyl (2α,18β)-3,4-didehydroibogamine-18-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| C00001704 | KNApSAcK |
| C09107 | KEGG COMPOUND |
| Catharanthine | Wikipedia |
| CPD-7859 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:2468-21-5 | KEGG COMPOUND |
| Citations |
|---|