EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| InChI | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). |
| Applications: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibutyl phthalate (CHEBI:34687) has functional parent butan-1-ol (CHEBI:28885) |
| dibutyl phthalate (CHEBI:34687) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| dibutyl phthalate (CHEBI:34687) has role environmental contaminant (CHEBI:78298) |
| dibutyl phthalate (CHEBI:34687) has role metabolite (CHEBI:25212) |
| dibutyl phthalate (CHEBI:34687) has role plasticiser (CHEBI:79056) |
| dibutyl phthalate (CHEBI:34687) has role teratogenic agent (CHEBI:50905) |
| dibutyl phthalate (CHEBI:34687) is a diester (CHEBI:51307) |
| dibutyl phthalate (CHEBI:34687) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dibutyl benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid dibutyl ester | ChemIDplus |
| Benzenedicarboxylic acid dibutyl ester | NIST Chemistry WebBook |
| Benzene-o-dicarboxylic acid di-n-butyl ester | NIST Chemistry WebBook |
| Benzene-o-dicarboxylic acid di-n-butyl ester | ChemIDplus |
| Butyl phthalate | ChemIDplus |
| DBP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2924 | PPDB |
| 4414 | DrugCentral |
| C14214 | KEGG COMPOUND |
| Dibutyl_phthalate | Wikipedia |
| HMDB0033244 | HMDB |
| Citations |
|---|