EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)OCCCCC |
| InChI | InChI=1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | IPKKHRVROFYTEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipentyl phthalate (CHEBI:34680) has functional parent pentan-1-ol (CHEBI:44884) |
| dipentyl phthalate (CHEBI:34680) has role plasticiser (CHEBI:79056) |
| dipentyl phthalate (CHEBI:34680) is a diester (CHEBI:51307) |
| dipentyl phthalate (CHEBI:34680) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dipentyl benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid dipentyl ester | ChemIDplus |
| Amyl phthalate | ChemIDplus |
| Diamyl phthalate | KEGG COMPOUND |
| di-n-Amyl phthalate | NIST Chemistry WebBook |
| Di-n-pentyl phthalate | KEGG COMPOUND |
| DPNP | ChEBI |
| Citations |
|---|