EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC |
| InChI | InChI=1S/C22H34O4/c1-3-5-7-9-13-17-25-21(23)19-15-11-12-16-20(19)22(24)26-18-14-10-8-6-4-2/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | JQCXWCOOWVGKMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diheptyl phthalate (CHEBI:34677) is a diester (CHEBI:51307) |
| diheptyl phthalate (CHEBI:34677) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| diheptyl benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| Di-n-heptyl phthalate | KEGG COMPOUND |
| DHPP | ChEBI |
| 1,2-Benzenedicarboxylic acid diheptyl ester | ChemIDplus |
| Phthalic acid diheptyl ester | ChemIDplus |
| Di-n-Heptylphthalate | ChemIDplus |
| Heptyl phthalate | ChemIDplus |
| Citations |
|---|