EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N3 |
| Net Charge | 0 |
| Average Mass | 175.235 |
| Monoisotopic Mass | 175.11095 |
| SMILES | N=C(N)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H13N3/c11-10(12)13-6-5-8-3-1-2-4-9(8)7-13/h1-4H,5-7H2,(H3,11,12) |
| InChIKey | JWPGJSVJDAJRLW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| debrisoquin (CHEBI:34665) has role adrenergic agent (CHEBI:37962) |
| debrisoquin (CHEBI:34665) has role antihypertensive agent (CHEBI:35674) |
| debrisoquin (CHEBI:34665) has role human metabolite (CHEBI:77746) |
| debrisoquin (CHEBI:34665) has role sympatholytic agent (CHEBI:66991) |
| debrisoquin (CHEBI:34665) is a carboxamidine (CHEBI:35359) |
| debrisoquin (CHEBI:34665) is a isoquinolines (CHEBI:24922) |
| Incoming Relation(s) |
| N-hydroxydebrisoquine O-glucuronide (CHEBI:65137) has functional parent debrisoquin (CHEBI:34665) |
| IUPAC Name |
|---|
| 3,4-dihydroisoquinoline-2(1H)-carboximidamide |
| INNs | Source |
|---|---|
| debrisoquina | ChEBI |
| debrisoquine | ChEBI |
| débrisoquine | ChEBI |
| debrisoquinum | ChEBI |
| Synonyms | Source |
|---|---|
| Debrisochinum | ChemIDplus |
| Debrisoquin | KEGG COMPOUND |
| Debrisoquine | KEGG COMPOUND |
| Isocaramidine | DrugBank |