EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34629 - chlordimeform
| Formula | C10H13ClN2 |
| Net Charge | 0 |
| Average Mass | 196.681 |
| Monoisotopic Mass | 196.07673 |
| SMILES | Cc1cc(Cl)ccc1/N=C/N(C)C |
| InChI | InChI=1S/C10H13ClN2/c1-8-6-9(11)4-5-10(8)12-7-13(2)3/h4-7H,1-3H3/b12-7+ |
| InChIKey | STUSTWKEFDQFFZ-KPKJPENVSA-N |
| Roles Classification |
|---|
| Applications: | antifeedant A substance that prevents pests from feeding. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlordimeform (CHEBI:34629) has role antifeedant (CHEBI:22583) |
| chlordimeform (CHEBI:34629) is a carboxamidine (CHEBI:35359) |
| chlordimeform (CHEBI:34629) is a formamidine acaricide (CHEBI:38489) |
| chlordimeform (CHEBI:34629) is a formamidine insecticide (CHEBI:38488) |
| chlordimeform (CHEBI:34629) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| N'-(4-chloro-2-methylphenyl)-N,N-dimethylimidoformamide |
| Synonyms | Source |
|---|---|
| Chlorphenamidine | KEGG COMPOUND |
| Chlordimeform | KEGG COMPOUND |
| N'-(4-Chloro-2-methylphenyl)-N,N-dimethylformamidine | KEGG COMPOUND |
| N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine | NIST Chemistry WebBook |
| N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine | NIST Chemistry WebBook |
| N'-(4-chloro-2-methylphenyl)-N,N-dimethylmethanimidamide | ChemIDplus |