EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2OS2 |
| Net Charge | 0 |
| Average Mass | 234.305 |
| Monoisotopic Mass | 233.99215 |
| SMILES | Cc1ccc2nc3sc(=O)sc3nc2c1 |
| InChI | InChI=1S/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
| InChIKey | FBQQHUGEACOBDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinomethionate (CHEBI:34620) has role agrochemical (CHEBI:33286) |
| quinomethionate (CHEBI:34620) is a dithioloquinoxaline (CHEBI:38919) |
| quinomethionate (CHEBI:34620) is a quinoxaline acaricide (CHEBI:38820) |
| quinomethionate (CHEBI:34620) is a quinoxaline antifungal agent (CHEBI:38819) |
| IUPAC Name |
|---|
| 6-methyl[1,3]dithiolo[4,5-b]quinoxalin-2-one |
| Synonyms | Source |
|---|---|
| Chinomethionat | KEGG COMPOUND |
| Quinomethionate | KEGG COMPOUND |
| 6-Methyl-2,3-quinoxalinedithiol cyclic S,S-dithiocarbonate | KEGG COMPOUND |
| chinomethionate | NIST Chemistry WebBook |
| oxythioquinox | ChemIDplus |
| S,S-(6-methylquinoxaline-2,3-diyl) dithiocarbonate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Morestan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14514 | KEGG COMPOUND |
| chinomethionat | Alan Wood's Pesticides |
| 127 | PPDB |
| Citations |
|---|