EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N7O8S4.2Na |
| Net Charge | 0 |
| Average Mass | 619.596 |
| Monoisotopic Mass | 618.96603 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)[O-])N1C(=O)[C@]2(NC(=O)C1SC(=C(C(N)=O)C(=O)[O-])S1)OC.[Na+].[Na+] |
| InChI | InChI=1S/C17H17N7O8S4.2Na/c1-23-16(20-21-22-23)34-4-5-3-33-15-17(32-2,14(31)24(15)7(5)11(29)30)19-9(26)13-35-12(36-13)6(8(18)25)10(27)28;;/h13,15H,3-4H2,1-2H3,(H2,18,25)(H,19,26)(H,27,28)(H,29,30);;/q;2*+1/p-2/b12-6-;;/t13?,15-,17+;;/m1../s1 |
| InChIKey | ZQQALMSFFARWPK-GLHLDKNHSA-L |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotetan disodium (CHEBI:34617) has part cefotetan(2−) (CHEBI:59358) |
| cefotetan disodium (CHEBI:34617) has role antibacterial drug (CHEBI:36047) |
| cefotetan disodium (CHEBI:34617) is a organic sodium salt (CHEBI:38700) |
| IUPAC Names |
|---|
| disodium (6R,7S)-7-({[4-(2-amino-1-carboxylato-2-oxoethylidene)-1,3-dithietan-2-yl]carbonyl}amino)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| disodium 7β-({[4-(2-amino-1-carboxylato-2-oxoethylidene)-1,3-dithietan-2-yl]carbonyl}amino)-7α-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylate |
| Synonyms | Source |
|---|---|
| Cefotetan disodium | KEGG COMPOUND |
| Cefotetan sodium | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D02228 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5716628 | Beilstein |
| CAS:74356-00-6 | ChemIDplus |