EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17N6O5S2.Na |
| Net Charge | 0 |
| Average Mass | 484.495 |
| Monoisotopic Mass | 484.05995 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C18H18N6O5S2.Na/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9;/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29);/q;+1/p-1/t11-,13-,16-;/m1./s1 |
| InChIKey | OJMNTWPPFNMOCJ-CFOLLTDRSA-M |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefamandole sodium (CHEBI:34614) has part cefamandole(1−) (CHEBI:53652) |
| cefamandole sodium (CHEBI:34614) has role antibacterial drug (CHEBI:36047) |
| cefamandole sodium (CHEBI:34614) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 7β-[(2R)-2-hydroxy-2-phenylacetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate |
| Synonyms | Source |
|---|---|
| cefamandole sodium salt | ChEBI |
| cephamandole sodium | ChEBI |
| cephamandole sodium salt | ChEBI |
| monosodium (6R,7R)-7-(R)-mandelamido-3-(((1-methyl-1-H-tetrazol-5-yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylate | ChemIDplus |
| sodium (6R,7R)-7-{[(2R)-2-hydroxy-2-phenylacetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Brand Name | Source |
|---|---|
| Kefdole | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4901274 | Reaxys |
| CAS:30034-03-8 | KEGG COMPOUND |
| CAS:30034-03-8 | ChemIDplus |