EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N3O6S |
| Net Charge | 0 |
| Average Mass | 405.432 |
| Monoisotopic Mass | 405.09946 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O6S/c1-9(22)27-7-11-8-28-17-13(16(24)21(17)14(11)18(25)26)20-15(23)12(19)10-5-3-2-4-6-10/h2-6,12-13,17H,7-8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1 |
| InChIKey | FUBBGQLTSCSAON-PBFPGSCMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefaloglycin (CHEBI:34613) has role antimicrobial agent (CHEBI:33281) |
| cefaloglycin (CHEBI:34613) is a cephalosporin (CHEBI:23066) |
| cefaloglycin (CHEBI:34613) is a β-lactam antibiotic allergen (CHEBI:88225) |
| IUPAC Names |
|---|
| (6R,7R)-3-(acetoxymethyl)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 3-acetoxymethyl-7β-[(2R)-2-amino-2-phenylacetamido]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| Cefaloglicina | ChemIDplus |
| Cefaloglycine | ChemIDplus |
| Cefaloglycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 7-(2-D-alpha-Aminophenylacetamido)cephalosporanic acid | ChemIDplus |
| 7-(D-2-Amino-2-phenylacetamido)-3-acetoxymethyl-delta(sup3)-cephem-4-carboxylic acid | ChemIDplus |
| 7-(D-alpha-Aminophenyl-acetamido)cephalosporanic acid | ChemIDplus |
| Cephaloglycine | ChemIDplus |
| Cephaoglycin acid | ChemIDplus |
| D-(-)-Cephaloglycin | ChemIDplus |
| Citations |
|---|