EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:34605 - CX-516
| Formula | C14H15N3O |
| Net Charge | 0 |
| Average Mass | 241.294 |
| Monoisotopic Mass | 241.12151 |
| SMILES | O=C(c1ccc2nccnc2c1)N1CCCCC1 |
| InChI | InChI=1S/C14H15N3O/c18-14(17-8-2-1-3-9-17)11-4-5-12-13(10-11)16-7-6-15-12/h4-7,10H,1-3,8-9H2 |
| InChIKey | ANDGGVOPIJEHOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CX-516 (CHEBI:34605) has role antipsychotic agent (CHEBI:35476) |
| CX-516 (CHEBI:34605) is a N-acylpiperidine (CHEBI:48591) |
| Synonyms | Source |
|---|---|
| Ampalex | ChEMBL |
| BDP 12 | ChEMBL |
| BDP-12 | ChEMBL |
| cx516 | ChEMBL |
| Cx516 | ChEMBL |
| CX 516 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C13675 | KEGG COMPOUND |
| Citations |
|---|