EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9ClO3 |
| Net Charge | 0 |
| Average Mass | 200.621 |
| Monoisotopic Mass | 200.02402 |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12) |
| InChIKey | DKHJWWRYTONYHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CPP (CHEBI:34603) has role phenoxy herbicide (CHEBI:60575) |
| CPP (CHEBI:34603) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 2-(p-Chlorophenoxy)propionic acid | KEGG COMPOUND |
| CPP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13701 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:3307-39-9 | KEGG COMPOUND |