EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CHBrCl2 |
| Net Charge | 0 |
| Average Mass | 163.829 |
| Monoisotopic Mass | 161.86387 |
| SMILES | [H]C(Cl)(Cl)Br |
| InChI | InChI=1S/CHBrCl2/c2-1(3)4/h1H |
| InChIKey | FMWLUWPQPKEARP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromodichloromethane (CHEBI:34591) has role environmental contaminant (CHEBI:78298) |
| bromodichloromethane (CHEBI:34591) has role reagent (CHEBI:33893) |
| bromodichloromethane (CHEBI:34591) is a halomethane (CHEBI:39279) |
| IUPAC Name |
|---|
| bromo(dichloro)methane |
| Synonyms | Source |
|---|---|
| Bromodichloromethane | KEGG COMPOUND |
| CHBrCl2 | IUPAC |
| dichlorobromomethane | NIST Chemistry WebBook |
| dichloromonobromomethane | NIST Chemistry WebBook |
| monobromodichloromethane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Bromodichloromethane | Wikipedia |
| C14708 | KEGG COMPOUND |
| Citations |
|---|