EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3(C)O)[C@]1([H])[C@H](C)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16+,17+,18-,19+,20+,21+/m1/s1 |
| InChIKey | IVFYLRMMHVYGJH-VLOLGRDOSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bolasterone (CHEBI:34583) has role androgen (CHEBI:50113) |
| Bolasterone (CHEBI:34583) is a 3-hydroxy steroid (CHEBI:36834) |
| INN | Source |
|---|---|
| bolasterona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17beta-Hydroxy-7alpha,17-dimethylandrost-4-en-3-one | KEGG COMPOUND |
| 7alpha,17alpha-Dimethyltestosterone | KEGG COMPOUND |
| 7.alpha.,17-dimethyltestosterone | ChEMBL |
| Bolasterone | KEGG COMPOUND |
| NSC-66233 | ChEMBL |
| U-19763 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C14475 | KEGG COMPOUND |
| D03144 | KEGG DRUG |
| HMDB0006048 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1605-89-6 | KEGG COMPOUND |
| Citations |
|---|