EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34575 - bisphenol F
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | Oc1ccc(Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H12O2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8,14-15H,9H2 |
| InChIKey | PXKLMJQFEQBVLD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. |
| Biological Roles: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisphenol F (CHEBI:34575) has role environmental food contaminant (CHEBI:78299) |
| bisphenol F (CHEBI:34575) has role xenoestrogen (CHEBI:76988) |
| bisphenol F (CHEBI:34575) is a bisphenol (CHEBI:22901) |
| bisphenol F (CHEBI:34575) is a diarylmethane (CHEBI:51614) |
| Incoming Relation(s) |
| bisphenol F diglycidyl ether (CHEBI:142451) has functional parent bisphenol F (CHEBI:34575) |
| IUPAC Name |
|---|
| 4-(4-hydroxybenzyl)phenol |
| Synonyms | Source |
|---|---|
| 4,4'-bisphenol F | ChEBI |
| 4,4'-Dihydroxydiphenylmethane | KEGG COMPOUND |
| 4,4'-methylenebis(phenol) | ChEBI |
| 4,4'-methylenediphenol | ChEBI |
| Bis(4-hydroxyphenyl)methane | KEGG COMPOUND |
| bis(para-hydroxyphenyl)methane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bisphenol_F | Wikipedia |
| C14298 | KEGG COMPOUND |
| Citations |
|---|