EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:34575 - bisphenol F
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | Oc1ccc(Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H12O2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8,14-15H,9H2 |
| InChIKey | PXKLMJQFEQBVLD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. |
| Biological Roles: | environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisphenol F (CHEBI:34575) has role environmental food contaminant (CHEBI:78299) |
| bisphenol F (CHEBI:34575) has role xenoestrogen (CHEBI:76988) |
| bisphenol F (CHEBI:34575) is a bisphenol (CHEBI:22901) |
| bisphenol F (CHEBI:34575) is a diarylmethane (CHEBI:51614) |
| Incoming Relation(s) |
| bisphenol F diglycidyl ether (CHEBI:142451) has functional parent bisphenol F (CHEBI:34575) |
| IUPAC Name |
|---|
| 4-(4-hydroxybenzyl)phenol |
| Synonyms | Source |
|---|---|
| 4,4'-bisphenol F | ChEBI |
| 4,4'-Dihydroxydiphenylmethane | KEGG COMPOUND |
| 4,4'-methylenebis(phenol) | ChEBI |
| 4,4'-methylenediphenol | ChEBI |
| Bis(4-hydroxyphenyl)methane | KEGG COMPOUND |
| bis(para-hydroxyphenyl)methane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bisphenol_F | Wikipedia |
| C14298 | KEGG COMPOUND |
| Citations |
|---|