EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12 |
| Net Charge | 0 |
| Average Mass | 252.316 |
| Monoisotopic Mass | 252.09390 |
| SMILES | c1ccc2c(c1)-c1cccc3c1c-2cc1ccccc13 |
| InChI | InChI=1S/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H |
| InChIKey | FTOVXSOBNPWTSH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[b]fluoranthene (CHEBI:34565) has role mutagen (CHEBI:25435) |
| benzo[b]fluoranthene (CHEBI:34565) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| benzo[e]acephenanthrylene |
| Synonyms | Source |
|---|---|
| Benzo[b]fluoranthene | KEGG COMPOUND |
| 3,4-Benzfluoranthene | KEGG COMPOUND |
| 2,3-Benzfluoranthene | ChemIDplus |
| 2,3-Benzofluoranthene | ChemIDplus |
| B(b)F | ChemIDplus |
| BF | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14320 | KEGG COMPOUND |
| Benzo(b)fluoranthene | Wikipedia |
| Citations |
|---|