EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34553 - Balofloxacin
| Formula | C20H24FN3O4 |
| Net Charge | 0 |
| Average Mass | 389.427 |
| Monoisotopic Mass | 389.17508 |
| SMILES | CN[C@@H]1CCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2OC)C1 |
| InChI | InChI=1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27)/t11-/m1/s1 |
| InChIKey | MGQLHRYJBWGORO-LLVKDONJSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Balofloxacin (CHEBI:34553) is a quinolines (CHEBI:26513) |
| Balofloxacin (CHEBI:34553) is a quinolone antibiotic (CHEBI:86324) |
| Synonyms | Source |
|---|---|
| Balofloxacin | KEGG COMPOUND |
| balofloxacin hydrate | DrugCentral |
| Q-Roxin | DrugCentral |