EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H65N15O12S2 |
| Net Charge | 0 |
| Average Mass | 1084.253 |
| Monoisotopic Mass | 1083.43785 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C46H65N15O12S2/c47-27-22-74-75-23-33(45(73)61-17-5-9-34(61)44(72)56-28(8-4-16-53-46(51)52)39(67)54-21-37(50)65)60-43(71)32(20-36(49)64)59-40(68)29(14-15-35(48)63)55-41(69)31(18-24-6-2-1-3-7-24)58-42(70)30(57-38(27)66)19-25-10-12-26(62)13-11-25/h1-3,6-7,10-13,27-34,62H,4-5,8-9,14-23,47H2,(H2,48,63)(H2,49,64)(H2,50,65)(H,54,67)(H,55,69)(H,56,72)(H,57,66)(H,58,70)(H,59,68)(H,60,71)(H4,51,52,53)/t27-,28-,29-,30-,31-,32-,33-,34-/m0/s1 |
| InChIKey | KBZOIRJILGZLEJ-LGYYRGKSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| argipressin (CHEBI:34543) has role cardiovascular drug (CHEBI:35554) |
| argipressin (CHEBI:34543) has role hematologic agent (CHEBI:50248) |
| argipressin (CHEBI:34543) has role mitogen (CHEBI:52290) |
| argipressin (CHEBI:34543) is a vasopressin (CHEBI:9937) |
| argipressin (CHEBI:34543) is conjugate base of argipressin(2+) (CHEBI:194507) |
| Incoming Relation(s) |
| argipressin(2+) (CHEBI:194507) is conjugate acid of argipressin (CHEBI:34543) |
| IUPAC Name |
|---|
| 1-{[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-arginylglycinamide |
| INNs | Source |
|---|---|
| argipresina | ChemIDplus |
| Argipressin | ChemIDplus |
| argipressine | ChemIDplus |
| argipressinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 8-Arginine-vasopressin | ChemIDplus |
| 8-L-arginine-vasopressin | ChemIDplus |
| 8-L-Arginine vasopressin | KEGG COMPOUND |
| ADH | KEGG COMPOUND |
| [Arg8]-vasopressin | ChEBI |
| arginine vasopressin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2810 | DrugCentral |
| C13662 | KEGG COMPOUND |
| D02983 | KEGG DRUG |
| Vasopressin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10773460 | Reaxys |
| CAS:113-79-1 | KEGG COMPOUND |
| CAS:113-79-1 | ChemIDplus |
| Citations |
|---|