EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6I3NO3 |
| Net Charge | 0 |
| Average Mass | 556.863 |
| Monoisotopic Mass | 556.74819 |
| SMILES | CC(=O)Nc1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C9H6I3NO3/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16/h2H,1H3,(H,13,14)(H,15,16) |
| InChIKey | GNOGSFBXBWBTIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acetrizoic acid (CHEBI:34521) is a aminobenzoic acid (CHEBI:22495) |
| Synonyms | Source |
|---|---|
| Acetrizoic acid | KEGG COMPOUND |
| sodium acetrizoate | DrugCentral |
| urokonic acid | DrugCentral |
| urokon | DrugCentral |
| acetrizoate sodium | DrugCentral |
| opacaron | DrugCentral |