EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)/b10-7- |
| InChIKey | FBUKMFOXMZRGRB-YFHOEESVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9(10)-EpOME (CHEBI:34494) is a epoxyoctadecenoic acid (CHEBI:72659) |
| 9(10)-EpOME (CHEBI:34494) is conjugate acid of 9(10)-EpOME(1−) (CHEBI:84023) |
| Incoming Relation(s) |
| (9R,10S)-9(10)-EpOME (CHEBI:86022) is a 9(10)-EpOME (CHEBI:34494) |
| 9(10)-EpOME(1−) (CHEBI:84023) is conjugate base of 9(10)-EpOME (CHEBI:34494) |
| IUPAC Name |
|---|
| 8-{3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}octanoic acid |
| Synonyms | Source |
|---|---|
| 9,10-EOA | HMDB |
| 9,10-epoxy-12Z-octadecenoic acid | LIPID MAPS |
| 9(10)-epoxyoctadec-12Z-enoic acid | ChEBI |
| 9,10-epoxyoctadec-12(Z)-enoic acid | HMDB |
| 9,10-epoxyoctadecenoic acid | HMDB |
| Coronaric acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004701 | HMDB |
| LMFA02000037 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4318495 | Reaxys |