EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C[C@H](O)C[C@]12[H] |
| InChI | InChI=1S/C19H30O2/c1-18-7-6-16-15(17(18)10-14(21)11-18)4-3-12-9-13(20)5-8-19(12,16)2/h3,13-17,20-21H,4-11H2,1-2H3/t13-,14+,15+,16-,17-,18+,19-/m0/s1 |
| InChIKey | CVCDJRPXEWJAAY-UVSUZTNJSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Androstene-3beta,16alpha-diol (CHEBI:34452) has role androgen (CHEBI:50113) |
| 5-Androstene-3beta,16alpha-diol (CHEBI:34452) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 3beta,16alpha-Dihydroxy-5-androstene | KEGG COMPOUND |
| 5-Androstene-3beta,16alpha-diol | KEGG COMPOUND |
| Cetadiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14631 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:3642-89-5 | KEGG COMPOUND |