EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34432 - 4-octylphenol
| Formula | C14H22O |
| Net Charge | 0 |
| Average Mass | 206.329 |
| Monoisotopic Mass | 206.16707 |
| SMILES | CCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12,15H,2-8H2,1H3 |
| InChIKey | NTDQQZYCCIDJRK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-octylphenol (CHEBI:34432) has role metabolite (CHEBI:25212) |
| 4-octylphenol (CHEBI:34432) has role surfactant (CHEBI:35195) |
| 4-octylphenol (CHEBI:34432) has role xenoestrogen (CHEBI:76988) |
| 4-octylphenol (CHEBI:34432) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| Nonidet P-40 (CHEBI:78708) has functional parent 4-octylphenol (CHEBI:34432) |
| IUPAC Name |
|---|
| 4-octylphenol |
| Synonyms | Source |
|---|---|
| p-octylphenol | KEGG COMPOUND |
| 1-(p-hydroxyphenyl)octane | ChemIDplus |
| 4-n-octylphenol | NIST Chemistry WebBook |
| Citations |
|---|