EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O2 |
| Net Charge | 0 |
| Average Mass | 224.259 |
| Monoisotopic Mass | 224.08373 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| InChIKey | PWWCDTYUYPOAIU-DHZHZOJOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxychalcone (CHEBI:34423) has functional parent trans-chalcone (CHEBI:48965) |
| 4-hydroxychalcone (CHEBI:34423) has role antihypertensive agent (CHEBI:35674) |
| 4-hydroxychalcone (CHEBI:34423) has role plant metabolite (CHEBI:76924) |
| 4-hydroxychalcone (CHEBI:34423) is a chalcones (CHEBI:23086) |
| 4-hydroxychalcone (CHEBI:34423) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| C14231 | KEGG COMPOUND |
| HMDB0032584 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2049157 | Reaxys |
| CAS:20426-12-4 | ChemIDplus |
| CAS:20426-12-4 | KEGG COMPOUND |
| Citations |
|---|