EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O4 |
| Net Charge | 0 |
| Average Mass | 406.482 |
| Monoisotopic Mass | 406.18926 |
| SMILES | COc1ccccc1OCCNCC(O)COc1cccc2nc3ccccc3c12 |
| InChI | InChI=1S/C24H26N2O4/c1-28-21-10-4-5-11-22(21)29-14-13-25-15-17(27)16-30-23-12-6-9-20-24(23)18-7-2-3-8-19(18)26-20/h2-12,17,25-27H,13-16H2,1H3 |
| InChIKey | OGHNVEJMJSYVRP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carvedilol (CHEBI:3441) has role antihypertensive agent (CHEBI:35674) |
| carvedilol (CHEBI:3441) has role cardiovascular drug (CHEBI:35554) |
| carvedilol (CHEBI:3441) has role vasodilator agent (CHEBI:35620) |
| carvedilol (CHEBI:3441) has role α-adrenergic antagonist (CHEBI:37890) |
| carvedilol (CHEBI:3441) has role β-adrenergic antagonist (CHEBI:35530) |
| carvedilol (CHEBI:3441) is a carbazoles (CHEBI:48513) |
| carvedilol (CHEBI:3441) is a secondary alcohol (CHEBI:35681) |
| carvedilol (CHEBI:3441) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 1-(9H-carbazol-4-yloxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol |
| INNs | Source |
|---|---|
| carvedilol | ChemIDplus |
| carvedilolum | WHO MedNet |
| carvédilol | WHO MedNet |
| carvedilol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Carvedilol | KEGG COMPOUND |
| (+-)-1-(Carbazol-4-yloxy)-3-((2-(o-methoxyphenoxy)ethyl)amino)-2-propanol | ChemIDplus |
| SKF 105517 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06875 | KEGG COMPOUND |
| D00255 | KEGG DRUG |
| DB01136 | DrugBank |
| DE2815926 | Patent |
| US4503067 | Patent |
| Carvedilol | Wikipedia |
| HMDB0015267 | HMDB |
| LSM-1310 | LINCS |
| 522 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1514452 | Reaxys |
| CAS:72956-09-3 | KEGG COMPOUND |
| CAS:72956-09-3 | ChemIDplus |
| Citations |
|---|