EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3440 - carvacrol
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | Cc1ccc(C(C)C)cc1O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| InChIKey | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. TRPA1 channel agonist An agonist at the transient receptor potential cation channel A1 (TRPA1). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carvacrol (CHEBI:3440) has parent hydride p-cymene (CHEBI:28768) |
| carvacrol (CHEBI:3440) has role agrochemical (CHEBI:33286) |
| carvacrol (CHEBI:3440) has role antimicrobial agent (CHEBI:33281) |
| carvacrol (CHEBI:3440) has role flavouring agent (CHEBI:35617) |
| carvacrol (CHEBI:3440) has role TRPA1 channel agonist (CHEBI:137514) |
| carvacrol (CHEBI:3440) has role volatile oil component (CHEBI:27311) |
| carvacrol (CHEBI:3440) is a p-menthane monoterpenoid (CHEBI:25186) |
| carvacrol (CHEBI:3440) is a botanical anti-fungal agent (CHEBI:86494) |
| carvacrol (CHEBI:3440) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-methyl-5-(propan-2-yl)phenol |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-methyl-5-isopropylbenzene | ChemIDplus |
| 1-Methyl-2-hydroxy-4-isopropylbenzene | ChemIDplus |
| 2-Hydroxy-p-cymene | ChemIDplus |
| 2-Methyl-5-(1-methylethyl)phenol | ChemIDplus |
| 2-Methyl-5-isopropylphenol | ChemIDplus |
| 2-p-Cymenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| carvacrol | UniProt |
| Citations |
|---|