EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3440 - carvacrol
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | Cc1ccc(C(C)C)cc1O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| InChIKey | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | TRPA1 channel agonist An agonist at the transient receptor potential cation channel A1 (TRPA1). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carvacrol (CHEBI:3440) has parent hydride p-cymene (CHEBI:28768) |
| carvacrol (CHEBI:3440) has role agrochemical (CHEBI:33286) |
| carvacrol (CHEBI:3440) has role antimicrobial agent (CHEBI:33281) |
| carvacrol (CHEBI:3440) has role flavouring agent (CHEBI:35617) |
| carvacrol (CHEBI:3440) has role TRPA1 channel agonist (CHEBI:137514) |
| carvacrol (CHEBI:3440) has role volatile oil component (CHEBI:27311) |
| carvacrol (CHEBI:3440) is a p-menthane monoterpenoid (CHEBI:25186) |
| carvacrol (CHEBI:3440) is a botanical anti-fungal agent (CHEBI:86494) |
| carvacrol (CHEBI:3440) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-methyl-5-(propan-2-yl)phenol |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-methyl-5-isopropylbenzene | ChemIDplus |
| 1-Methyl-2-hydroxy-4-isopropylbenzene | ChemIDplus |
| 2-Hydroxy-p-cymene | ChemIDplus |
| 2-Methyl-5-(1-methylethyl)phenol | ChemIDplus |
| 2-Methyl-5-isopropylphenol | ChemIDplus |
| 2-p-Cymenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| carvacrol | UniProt |
| Citations |
|---|