EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:34395 |
| ChEBI Name | 4-chloro-m-cresol |
| Stars | |
| ASCII Name | 4-chloro-m-cresol |
| Definition | A hydroxytoluene that is 3-methylphenol which is substituted by a chlorine at position 4. A ryanodine receptor agonist. |
| Last Modified | 25 February 2020 |
| Downloads |
| Formula | C7H7ClO |
| Net Charge | 0 |
| Average Mass | 142.585 |
| Monoisotopic Mass | 142.01854 |
| SMILES | Cc1cc(O)ccc1Cl |
| InChI | InChI=1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChIKey | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. ryanodine receptor agonist A ryanodine receptor modulator which activates the receptor. Ryanodine receptors (RyRs) act as selective ion channels, modulating the release of calcium. Activating the receptors causes the release of calcium, so depleting internal calcium and ultimately preventing further muscle contraction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-m-cresol (CHEBI:34395) has role antimicrobial agent (CHEBI:33281) |
| 4-chloro-m-cresol (CHEBI:34395) has role disinfectant (CHEBI:48219) |
| 4-chloro-m-cresol (CHEBI:34395) has role ryanodine receptor agonist (CHEBI:67114) |
| 4-chloro-m-cresol (CHEBI:34395) is a hydroxytoluene (CHEBI:24751) |
| 4-chloro-m-cresol (CHEBI:34395) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 4-chloro-3-methylphenol |
| Synonyms | Source |
|---|---|
| 1-chloro-2-methyl-4-hydroxybenzene | NIST Chemistry WebBook |
| 2-chloro-5-hydroxytoluene | NIST Chemistry WebBook |
| 3-methyl-4-chlorophenol | NIST Chemistry WebBook |
| 4-chloro-5-methylphenol | NIST Chemistry WebBook |
| 6-chloro-3-hydroxytoluene | NIST Chemistry WebBook |
| para-chloro-meta-cresol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 43M | PDBeChem |
| C14331 | KEGG COMPOUND |
| D03468 | KEGG DRUG |
| P-Chlorocresol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:59-50-7 | KEGG COMPOUND |
| CAS:59-50-7 | NIST Chemistry WebBook |
| Citations |
|---|