EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9ClO |
| Net Charge | 0 |
| Average Mass | 156.612 |
| Monoisotopic Mass | 156.03419 |
| SMILES | Cc1cc(O)cc(C)c1Cl |
| InChI | InChI=1S/C8H9ClO/c1-5-3-7(10)4-6(2)8(5)9/h3-4,10H,1-2H3 |
| InChIKey | OSDLLIBGSJNGJE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| Applications: | molluscicide A substance used to destroy pests of the phylum Mollusca. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) has functional parent 3,5-xylenol (CHEBI:38572) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) has role antiseptic drug (CHEBI:48218) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) has role disinfectant (CHEBI:48219) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) has role molluscicide (CHEBI:33904) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) is a monochlorobenzenes (CHEBI:83403) |
| 4-chloro-3,5-dimethylphenol (CHEBI:34393) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-chloro-3,5-dimethylphenol |
| INNs | Source |
|---|---|
| chloroxylenol | ChemIDplus |
| chloroxylénol | WHO MedNet |
| chloroxylenolum | ChemIDplus |
| cloroxilenol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-chloro-5-hydroxy-1,3-dimethylbenzene | ChemIDplus |
| 2-chloro-5-hydroxy-m-xylene | ChemIDplus |
| 2-Chloro-m-xylenol | ChemIDplus |
| 3,5-dimethyl-4-chlorophenol | ChemIDplus |
| 4-chloro-1-hydroxy-3,5-dimethylbenzene | ChemIDplus |
| 4-chloro-m-xylenol | ChemIDplus |
| Brand Names | Source |
|---|---|
| Benzytol | ChemIDplus |
| Dettol | ChemIDplus |
| Citations |
|---|