EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CCC3=C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-17,20-21H,3-10H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | BTTWKVFKBPAFDK-LOVVWNRFSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Androstenediol (CHEBI:34386) has role androgen (CHEBI:50113) |
| 4-Androstenediol (CHEBI:34386) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 4-Androstenediol | KEGG COMPOUND |
| Androst-4-ene-3beta,17beta-diol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14210 | KEGG COMPOUND |
| HMDB0005849 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1156-92-9 | KEGG COMPOUND |