EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O2 |
| Net Charge | 0 |
| Average Mass | 140.142 |
| Monoisotopic Mass | 140.05858 |
| SMILES | O=c1noc2c1CCNC2 |
| InChI | InChI=1S/C6H8N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h7H,1-3H2,(H,8,9) |
| InChIKey | ZXRVKCBLGJOCEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gaboxadol (CHEBI:34373) has role GABAA receptor agonist (CHEBI:91016) |
| gaboxadol (CHEBI:34373) has role hallucinogen (CHEBI:35499) |
| gaboxadol (CHEBI:34373) has role sedative (CHEBI:35717) |
| gaboxadol (CHEBI:34373) is a oxazolopyridine (CHEBI:38765) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrahydro[1,2]oxazolo[5,4-c]pyridin-3(2H)-one |
| INNs | Source |
|---|---|
| gaboxadol | WHO MedNet |
| gaboxadol | WHO MedNet |
| gaboxadol | WHO MedNet |
| gaboxadolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridin-3(2H)-one | ChEBI |
| Lu 02-030 | CAS |
| LU-02030 | ChEBI |
| LU 2030 | ChEBI |
| LU-2-030 | ChEBI |
| MK-0928 | ChEBI |
| Citations |
|---|