EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O2 |
| Net Charge | 0 |
| Average Mass | 140.142 |
| Monoisotopic Mass | 140.05858 |
| SMILES | O=c1noc2c1CCNC2 |
| InChI | InChI=1S/C6H8N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h7H,1-3H2,(H,8,9) |
| InChIKey | ZXRVKCBLGJOCEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gaboxadol (CHEBI:34373) has role GABAA receptor agonist (CHEBI:91016) |
| gaboxadol (CHEBI:34373) has role hallucinogen (CHEBI:35499) |
| gaboxadol (CHEBI:34373) has role sedative (CHEBI:35717) |
| gaboxadol (CHEBI:34373) is a oxazolopyridine (CHEBI:38765) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrahydro[1,2]oxazolo[5,4-c]pyridin-3(2H)-one |
| INNs | Source |
|---|---|
| gaboxadol | WHO MedNet |
| gaboxadol | WHO MedNet |
| gaboxadol | WHO MedNet |
| gaboxadolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridin-3(2H)-one | ChEBI |
| Lu 02-030 | CAS |
| LU-02030 | ChEBI |
| LU 2030 | ChEBI |
| LU-2-030 | ChEBI |
| MK-0928 | ChEBI |
| Citations |
|---|