EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O2 |
| Net Charge | 0 |
| Average Mass | 224.259 |
| Monoisotopic Mass | 224.08373 |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H/b11-6+ |
| InChIKey | UAHGNXFYLAJDIN-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-hydroxychalcone (CHEBI:34360) has role anti-inflammatory agent (CHEBI:67079) |
| 4'-hydroxychalcone (CHEBI:34360) has role antineoplastic agent (CHEBI:35610) |
| 4'-hydroxychalcone (CHEBI:34360) is a chalcones (CHEBI:23086) |
| 4'-hydroxychalcone (CHEBI:34360) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
| Citations |
|---|