EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O2S2 |
| Net Charge | 0 |
| Average Mass | 237.350 |
| Monoisotopic Mass | 237.06057 |
| SMILES | CN(C)C(CSC(N)=O)CSC(N)=O |
| InChI | InChI=1S/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12) |
| InChIKey | IRUJZVNXZWPBMU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cartap (CHEBI:3436) is a nereistoxin analogue insecticide (CHEBI:39191) |
| IUPAC Name |
|---|
| S,S'-[2-(dimethylamino)propane-1,3-diyl] bis(thiocarbamate) |
| Synonyms | Source |
|---|---|
| 1,3-bis(carbamoylthio)-2-(N,N-dimethylamino)propane | ChemIDplus |
| 1,3-di(carbamoylthio)-2-dimethylaminopropane | ChemIDplus |
| 2-dimethylamino-1,3-bis(carbamoylthio)propane | ChemIDplus |
| carbamothioic acid, S,S'-(2-(dimethylamino)-1,3-propanediyl) ester | ChemIDplus |
| Cartap | KEGG COMPOUND |
| S,S'-(2-(dimethylamino)-1,3-propanediyl) dicarbamothioate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1954913 | Beilstein |
| CAS:15263-53-3 | KEGG COMPOUND |
| CAS:15263-53-3 | ChemIDplus |