EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)C[C@H](O)[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h11-15,17,20-21H,3-10H2,1-2H3/t11-,12+,13-,14-,15-,17+,18-,19-/m0/s1 |
| InChIKey | PIXFHVWJOVNKQK-PTXZMSDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (11085621) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,11beta-Dihydroxy-5alpha-androstane-17-one (CHEBI:34350) has role androgen (CHEBI:50113) |
| 3alpha,11beta-Dihydroxy-5alpha-androstane-17-one (CHEBI:34350) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 11beta-hydroxy-androsterone | HMDB |
| 11-beta-Hydroxyandrosterone | HMDB |
| 11beta-Hydroxyandrosterone | KEGG COMPOUND |
| 11-Hydroxy-androsterone | HMDB |
| 11-Hydroxyetiocholanolone | HMDB |
| (1S,2S,5R,7S,10S,11S,15S,17S)-5,17-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-one | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C14606 | KEGG COMPOUND |
| HMDB0002984 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:57-61-4 | KEGG COMPOUND |
| Citations |
|---|