EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18Cl3NO |
| Net Charge | 0 |
| Average Mass | 334.674 |
| Monoisotopic Mass | 333.04540 |
| SMILES | CCC1(C(=O)NC(C)c2ccc(Cl)cc2)C(C)C1(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3NO/c1-4-14(10(3)15(14,17)18)13(20)19-9(2)11-5-7-12(16)8-6-11/h5-10H,4H2,1-3H3,(H,19,20) |
| InChIKey | RXDMAYSSBPYBFW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 4.2.1.94 (scytalone dehydratase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of scytalone dehydratase (EC 4.2.1.94). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carpropamid (CHEBI:3434) has role antifungal agrochemical (CHEBI:86328) |
| carpropamid (CHEBI:3434) has role EC 4.2.1.94 (scytalone dehydratase) inhibitor (CHEBI:84012) |
| carpropamid (CHEBI:3434) has role melanin synthesis inhibitor (CHEBI:64933) |
| carpropamid (CHEBI:3434) has role xenobiotic (CHEBI:35703) |
| carpropamid (CHEBI:3434) is a amide fungicide (CHEBI:60600) |
| carpropamid (CHEBI:3434) is a cyclopropylcarboxamide (CHEBI:51456) |
| carpropamid (CHEBI:3434) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| (1S,3R)-2,2-dichloro-N-[(1R)-1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropanecarboxamide (CHEBI:47351) is a carpropamid (CHEBI:3434) |
| IUPAC Name |
|---|
| 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropanecarboxamide |
| Synonym | Source |
|---|---|
| Carpropamid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10932 | KEGG COMPOUND |
| EP170842 | Patent |
| US4710518 | Patent |
| DE19956120 | Patent |
| carpropamid | Alan Wood's Pesticides |
| 1019 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10554099 | Reaxys |
| CAS:104030-54-8 | KEGG COMPOUND |
| CAS:104030-54-8 | ChemIDplus |
| Citations |
|---|