EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34304 - fenobucarb
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | CCC(C)c1ccccc1OC(=O)NC |
| InChI | InChI=1S/C12H17NO2/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
| InChIKey | DIRFUJHNVNOBMY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenobucarb (CHEBI:34304) has functional parent 2-sec-butylphenol (CHEBI:34303) |
| fenobucarb (CHEBI:34304) has functional parent methylcarbamic acid (CHEBI:45379) |
| fenobucarb (CHEBI:34304) has role agrochemical (CHEBI:33286) |
| fenobucarb (CHEBI:34304) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| fenobucarb (CHEBI:34304) has role environmental contaminant (CHEBI:78298) |
| fenobucarb (CHEBI:34304) has role herbicide (CHEBI:24527) |
| fenobucarb (CHEBI:34304) has role insecticide (CHEBI:24852) |
| fenobucarb (CHEBI:34304) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| 2-(butan-2-yl)phenyl methylcarbamate |
| Synonyms | Source |
|---|---|
| 2-sec-Butylphenyl N-methylcarbamate | KEGG COMPOUND |
| BPMC | KEGG COMPOUND |
| Fenobucarb | KEGG COMPOUND |
| 2-(1-methylpropyl)phenyl methylcarbamate | IUPAC |
| 2-sec-Butylphenyl methylcarbamate | ChemIDplus |
| Methylcarbamic acid o-sec-butylphenyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14425 | KEGG COMPOUND |
| Fenobucarb | Wikipedia |
| 1183 | PPDB |
| Citations |
|---|